EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O5 |
| Net Charge | 0 |
| Average Mass | 172.136 |
| Monoisotopic Mass | 172.03717 |
| SMILES | O=C(O)C/C=C/CC(=O)C(=O)O |
| InChI | InChI=1S/C7H8O5/c8-5(7(11)12)3-1-2-4-6(9)10/h1-2H,3-4H2,(H,9,10)(H,11,12)/b2-1+ |
| InChIKey | ICGKEQXHPZUYSF-OWOJBTEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxohept-4-ene-1,7-dioic acid (CHEBI:82686) is a dicarboxylic fatty acid (CHEBI:189840) |
| 2-oxohept-4-ene-1,7-dioic acid (CHEBI:82686) is a olefinic compound (CHEBI:78840) |
| 2-oxohept-4-ene-1,7-dioic acid (CHEBI:82686) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2-oxohept-4-ene-1,7-dioic acid (CHEBI:82686) is conjugate acid of 2-oxohept-4-ene-1,7-dioate (CHEBI:78627) |
| 2-oxohept-4-ene-1,7-dioic acid (CHEBI:82686) is tautomer of 2-hydroxyhepta-2,4-dienedioic acid (CHEBI:1162) |
| Incoming Relation(s) |
| 2-oxohept-4-ene-1,7-dioate (CHEBI:78627) is conjugate base of 2-oxohept-4-ene-1,7-dioic acid (CHEBI:82686) |
| 2-hydroxyhepta-2,4-dienedioic acid (CHEBI:1162) is tautomer of 2-oxohept-4-ene-1,7-dioic acid (CHEBI:82686) |
| IUPAC Name |
|---|
| (3E)-6-oxohept-3-enedioic acid |
| Synonym | Source |
|---|---|
| 2-ketohept-4-ene-1,7-dioic acid | ChEBI |