EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O3 |
| Net Charge | 0 |
| Average Mass | 284.355 |
| Monoisotopic Mass | 284.14124 |
| SMILES | O=C(O)CCCCCCC/C=C\C#CC#Cc1ccco1 |
| InChI | InChI=1S/C18H20O3/c19-18(20)15-11-9-7-5-3-1-2-4-6-8-10-13-17-14-12-16-21-17/h2,4,12,14,16H,1,3,5,7,9,11,15H2,(H,19,20)/b4-2- |
| InChIKey | AKBAHATYKFKXLG-RQOWECAXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pomecin A (CHEBI:82672) has role antifungal agent (CHEBI:35718) |
| pomecin A (CHEBI:82672) has role plant metabolite (CHEBI:76924) |
| pomecin A (CHEBI:82672) is a acetylenic fatty acid (CHEBI:25380) |
| pomecin A (CHEBI:82672) is a furans (CHEBI:24129) |
| pomecin A (CHEBI:82672) is a olefinic fatty acid (CHEBI:53339) |
| pomecin A (CHEBI:82672) is a polyunsaturated fatty acid (CHEBI:26208) |
| IUPAC Name |
|---|
| (9Z)-14-(2-furyl)tetradec-9-ene-11,13-diynoic acid |
| Synonyms | Source |
|---|---|
| EV-086 | ChEBI |
| (Z)-14-(furan-2-yl)tetradeca-9-en-11,13-diynoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21180385 | Reaxys |
| Citations |
|---|