EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24ClN3O4 |
| Net Charge | 0 |
| Average Mass | 453.926 |
| Monoisotopic Mass | 453.14553 |
| SMILES | COc1cc2cc(C(=O)Nc3cc(N)c4ccccc4c3CCCl)nc2c(OC)c1OC |
| InChI | InChI=1S/C24H24ClN3O4/c1-30-20-11-13-10-19(27-21(13)23(32-3)22(20)31-2)24(29)28-18-12-17(26)15-7-5-4-6-14(15)16(18)8-9-25/h4-7,10-12,27H,8-9,26H2,1-3H3,(H,28,29) |
| InChIKey | MNFPZBOQEWMBOK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AS-I-145 (CHEBI:82669) has role antineoplastic agent (CHEBI:35610) |
| AS-I-145 (CHEBI:82669) is a aromatic amine (CHEBI:33860) |
| AS-I-145 (CHEBI:82669) is a aromatic ether (CHEBI:35618) |
| AS-I-145 (CHEBI:82669) is a indolecarboxamide (CHEBI:46921) |
| AS-I-145 (CHEBI:82669) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| N-[4-amino-1-(2-chloroethyl)-2-naphthyl]-5,6,7-trimethoxy-1H-indole-2-carboxamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10125806 | Reaxys |
| Citations |
|---|