EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C28H26ClN2 |
| Net Charge | 0 |
| Average Mass | 505.887 |
| Monoisotopic Mass | 504.09679 |
| SMILES | CCCC[n+]1ccc2c3ccccc3n(Cc3ccccc3)c2c1-c1ccccc1Cl.[Br-] |
| InChI | InChI=1S/C28H26ClN2.BrH/c1-2-3-18-30-19-17-23-22-13-8-10-16-26(22)31(20-21-11-5-4-6-12-21)28(23)27(30)24-14-7-9-15-25(24)29;/h4-17,19H,2-3,18,20H2,1H3;1H/q+1;/p-1 |
| InChIKey | MABQGZCUZBRXEX-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.22 (cyclin-dependent kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of cyclin-dependent kinase (EC 2.7.11.22). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DH334 (CHEBI:82662) has part DH334(1+) (CHEBI:82666) |
| DH334 (CHEBI:82662) has role antineoplastic agent (CHEBI:35610) |
| DH334 (CHEBI:82662) has role EC 2.7.11.22 (cyclin-dependent kinase) inhibitor (CHEBI:82665) |
| DH334 (CHEBI:82662) is a organic bromide salt (CHEBI:48369) |
| IUPAC Name |
|---|
| 9-benzyl-2-butyl-1-(2-chlorophenyl)-9H-β-carbolin-2-ium bromide |
| Synonyms | Source |
|---|---|
| DH 334 | ChEBI |
| DH-334 | ChEBI |
| Citations |
|---|