EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O4 |
| Net Charge | 0 |
| Average Mass | 266.337 |
| Monoisotopic Mass | 266.15181 |
| SMILES | [H]C1(O)[C@@]2(C)[C@]3(CO3)C[C@]1(O)O[C@@]1([H])C=C(C)CC[C@]21C |
| InChI | InChI=1S/C15H22O4/c1-9-4-5-12(2)10(6-9)19-15(17)7-14(8-18-14)13(12,3)11(15)16/h6,10-11,16-17H,4-5,7-8H2,1-3H3/t10-,11?,12-,13+,14+,15-/m0/s1 |
| InChIKey | SSTQGEBHEZQSQQ-HCKLQLJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curvularia (ncbitaxon:5502) | - | PubMed (17031058) | Strain: RK97-F166 |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| curvularol (CHEBI:82660) has role fungal metabolite (CHEBI:76946) |
| curvularol (CHEBI:82660) is a bridged compound (CHEBI:35990) |
| curvularol (CHEBI:82660) is a cyclic hemiketal (CHEBI:59780) |
| curvularol (CHEBI:82660) is a organic heterotricyclic compound (CHEBI:26979) |
| curvularol (CHEBI:82660) is a spiro-epoxide (CHEBI:133131) |
| IUPAC Name |
|---|
| (2S,4S,5S,5aR,9aS,10S)-5,5a,8-trimethyl-5a,6,7,9a-tetrahydro-5H-spiro[2,5-methano[1]benzoxepine-4,2'-oxirane]-2,10(3H)-diol |
| Manual Xrefs | Databases |
|---|---|
| C00015733 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:339293-67-3 | KNApSAcK |