EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO3 |
| Net Charge | 0 |
| Average Mass | 301.386 |
| Monoisotopic Mass | 301.16779 |
| SMILES | C[C@@H](CCc1ccc(O)cc1)NC[C@@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H23NO3/c1-13(2-3-14-4-8-16(20)9-5-14)19-12-18(22)15-6-10-17(21)11-7-15/h4-11,13,18-22H,2-3,12H2,1H3/t13-,18+/m0/s1 |
| InChIKey | YJQZYXCXBBCEAQ-SCLBCKFNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-butopamine (CHEBI:82649) is a 4-(1-hydroxy-2-{[4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)phenol (CHEBI:82647) |
| ent-butopamine (CHEBI:82649) is enantiomer of butopamine (CHEBI:82648) |
| Incoming Relation(s) |
| ractopamine (CHEBI:82644) has part ent-butopamine (CHEBI:82649) |
| butopamine (CHEBI:82648) is enantiomer of ent-butopamine (CHEBI:82649) |
| IUPAC Name |
|---|
| 4-[(1S)-1-hydroxy-2-{[(2S)-4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl]phenol |
| Synonym | Source |
|---|---|
| (S,S)-ractopamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8395949 | Reaxys |
| Citations |
|---|