EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23NO4 |
| Net Charge | 0 |
| Average Mass | 329.396 |
| Monoisotopic Mass | 329.16271 |
| SMILES | COc1ccc(NC(=O)COc2cccc(OCC(C)C)c2)cc1 |
| InChI | InChI=1S/C19H23NO4/c1-14(2)12-23-17-5-4-6-18(11-17)24-13-19(21)20-15-7-9-16(22-3)10-8-15/h4-11,14H,12-13H2,1-3H3,(H,20,21) |
| InChIKey | JNQHDEHVHXLCAL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | glycerophosphoinositol synthesis inhibitor A pathway inhibitor that disrupts the synthesis of glycerophosphoinositol antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gepinacin (CHEBI:82641) has functional parent phenylacetic acid (CHEBI:30745) |
| gepinacin (CHEBI:82641) has role antifungal agent (CHEBI:35718) |
| gepinacin (CHEBI:82641) has role glycerophosphoinositol synthesis inhibitor (CHEBI:79386) |
| gepinacin (CHEBI:82641) is a aromatic amide (CHEBI:62733) |
| gepinacin (CHEBI:82641) is a aromatic ether (CHEBI:35618) |
| gepinacin (CHEBI:82641) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 2-(3-isobutoxyphenoxy)-N-(4-methoxyphenyl)acetamide |
| Manual Xrefs | Databases |
|---|---|
| WO2013192517 | Patent |
| Citations |
|---|