EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O4 |
| Net Charge | 0 |
| Average Mass | 250.294 |
| Monoisotopic Mass | 250.12051 |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C(=O)O)O2 |
| InChI | InChI=1S/C14H18O4/c1-7-8(2)12-10(9(3)11(7)15)5-6-14(4,18-12)13(16)17/h15H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | GLEVLJDDWXEYCO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trolox (CHEBI:82625) has role antioxidant (CHEBI:22586) |
| Trolox (CHEBI:82625) has role ferroptosis inhibitor (CHEBI:173084) |
| Trolox (CHEBI:82625) has role neuroprotective agent (CHEBI:63726) |
| Trolox (CHEBI:82625) has role radical scavenger (CHEBI:48578) |
| Trolox (CHEBI:82625) has role Wnt signalling inhibitor (CHEBI:78031) |
| Trolox (CHEBI:82625) is a chromanol (CHEBI:23229) |
| Trolox (CHEBI:82625) is a monocarboxylic acid (CHEBI:25384) |
| Trolox (CHEBI:82625) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 6-hydroxy-2,5,7,8-tetramethylchromane-2-carboxylic acid | ChEBI |
| 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl-2H-1-benzopyran-2-carboxylic acid | ChemIDplus |
| 6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid | IUPAC |
| 6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Trolox C | ChemIDplus |
| Trolox | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038804 | HMDB |
| Trolox | Wikipedia |
| LSM-4987 | LINCS |
| FDB018229 | FooDB |
| 37117 | ChemSpider |
| JP2006306808 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5052542 | Reaxys |
| CAS:53188-07-1 | ChemIDplus |
| Citations |
|---|