EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O5 |
| Net Charge | 0 |
| Average Mass | 358.434 |
| Monoisotopic Mass | 358.17802 |
| SMILES | [H][C@]1(C(=O)CCCCC)C(=O)O[C@@]2(C)C(=O)C3=C(C=C(/C=C/C)OC3)C[C@]12[H] |
| InChI | InChI=1S/C21H26O5/c1-4-6-7-9-17(22)18-16-11-13-10-14(8-5-2)25-12-15(13)19(23)21(16,3)26-20(18)24/h5,8,10,16,18H,4,6-7,9,11-12H2,1-3H3/b8-5+/t16-,18+,21-/m1/s1 |
| InChIKey | XXKNHBAFFJINCK-RVEJDSBJSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. PPARgamma agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-γ. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monascin (CHEBI:82621) has role antilipemic drug (CHEBI:35679) |
| monascin (CHEBI:82621) has role antineoplastic agent (CHEBI:35610) |
| monascin (CHEBI:82621) has role fungal metabolite (CHEBI:76946) |
| monascin (CHEBI:82621) has role PPARγ agonist (CHEBI:71554) |
| monascin (CHEBI:82621) is a organic heterotricyclic compound (CHEBI:26979) |
| monascin (CHEBI:82621) is a polyketide (CHEBI:26188) |
| monascin (CHEBI:82621) is a α,β-unsaturated ketone (CHEBI:51721) |
| monascin (CHEBI:82621) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3S,3aR,9aR)-3-hexanoyl-9a-methyl-6-[(1E)-prop-1-en-1-yl]-3a,4,8,9a-tetrahydro-2H-furo[3,2-g][2]benzopyran-2,9(3H)-dione |
| Synonym | Source |
|---|---|
| monascusone B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:51355 | Reaxys |
| CAS:21516-68-7 | ChemIDplus |
| Citations |
|---|