EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82619 - icariside II
| Formula | C27H30O10 |
| Net Charge | 0 |
| Average Mass | 514.527 |
| Monoisotopic Mass | 514.18390 |
| SMILES | COc1ccc(-c2oc3c(CC=C(C)C)c(O)cc(O)c3c(=O)c2O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C27H30O10/c1-12(2)5-10-16-17(28)11-18(29)19-21(31)26(37-27-23(33)22(32)20(30)13(3)35-27)24(36-25(16)19)14-6-8-15(34-4)9-7-14/h5-9,11,13,20,22-23,27-30,32-33H,10H2,1-4H3/t13-,20-,22+,23+,27-/m0/s1 |
| InChIKey | NGMYNFJANBHLKA-LVKFHIPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epimedium koreanum (ncbitaxon:63351) | root (BTO:0001188) | PubMed (22051934) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icariside II (CHEBI:82619) has functional parent α-L-rhamnopyranose (CHEBI:27907) |
| icariside II (CHEBI:82619) has role anti-inflammatory agent (CHEBI:67079) |
| icariside II (CHEBI:82619) has role antineoplastic agent (CHEBI:35610) |
| icariside II (CHEBI:82619) has role apoptosis inducer (CHEBI:68495) |
| icariside II (CHEBI:82619) has role plant metabolite (CHEBI:76924) |
| icariside II (CHEBI:82619) is a glycosyloxyflavone (CHEBI:50018) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-3-yl 6-deoxy-α-L-mannopyranoside |
| Synonyms | Source |
|---|---|
| baohuoside I | ChemIDplus |
| 3,5,7-trihydroxy-4'-methoxy-8-prenylflavone-3-O-rhamnopyranoside | ChemIDplus |
| 3,5,7-trihydroxy-4'-methoxy-8-prenylflavone-3-O-α-L-rhamnopyranoside | ChEBI |
| anhydroicaritin-3-O-α-L-rhamnopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:71248 | Reaxys |
| CAS:113558-15-9 | ChemIDplus |
| Citations |
|---|