EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C22H22NO4S2.Ca |
| Net Charge | 0 |
| Average Mass | 897.188 |
| Monoisotopic Mass | 896.16064 |
| SMILES | C[C@H](CSC(=O)c1ccccc1)C(=O)N1C[C@@H](Sc2ccccc2)C[C@H]1C(=O)[O-].C[C@H](CSC(=O)c1ccccc1)C(=O)N1C[C@@H](Sc2ccccc2)C[C@H]1C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C22H23NO4S2.Ca/c2*1-15(14-28-22(27)16-8-4-2-5-9-16)20(24)23-13-18(12-19(23)21(25)26)29-17-10-6-3-7-11-17;/h2*2-11,15,18-19H,12-14H2,1H3,(H,25,26);/q;;+2/p-2/t2*15-,18+,19+;/m11./s1 |
| InChIKey | NSYUKKYYVFVMST-LETVYOFWSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. cardioprotective agent Any protective agent that is able to prevent damage to the heart. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). vasodilator agent A drug used to cause dilation of the blood vessels. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zofenopril calcium (CHEBI:82600) has part zofenopril(1−) (CHEBI:82601) |
| zofenopril calcium (CHEBI:82600) has role anticonvulsant (CHEBI:35623) |
| zofenopril calcium (CHEBI:82600) has role apoptosis inhibitor (CHEBI:68494) |
| zofenopril calcium (CHEBI:82600) has role cardioprotective agent (CHEBI:77307) |
| zofenopril calcium (CHEBI:82600) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| zofenopril calcium (CHEBI:82600) has role prodrug (CHEBI:50266) |
| zofenopril calcium (CHEBI:82600) has role vasodilator agent (CHEBI:35620) |
| zofenopril calcium (CHEBI:82600) is a organic calcium salt (CHEBI:51031) |
| IUPAC Name |
|---|
| calcium bis[(2S,4S)-1-[(2S)-3-(benzoylsulfanyl)-2-methylpropanoyl]-4-(phenylsulfanyl)pyrrolidine-2-carboxylate] |
| Synonym | Source |
|---|---|
| SQ 26991 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Zoprace | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D03767 | KEGG DRUG |
| Zofenopril | Wikipedia |
| US2011028736 | Patent |
| US2011118328 | Patent |
| WO2007138352 | Patent |
| US2009176860 | Patent |
| CA2653333 | Patent |
| EP2041083 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6466976 | Reaxys |
| CAS:81938-43-4 | KEGG DRUG |
| CAS:81938-43-4 | ChemIDplus |
| Citations |
|---|