EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O2 |
| Net Charge | 0 |
| Average Mass | 290.362 |
| Monoisotopic Mass | 290.13068 |
| SMILES | Cc1c2c(c(C)c3ccccc13)[C@H](O)[C@@H](O)c1ccccc1-2 |
| InChI | InChI=1S/C20H18O2/c1-11-13-7-3-4-8-14(13)12(2)18-17(11)15-9-5-6-10-16(15)19(21)20(18)22/h3-10,19-22H,1-2H3/t19-,20-/m0/s1 |
| InChIKey | SGVWCDYKBWRHKJ-PMACEKPBSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-5,6-Dihydro-5,6-dihydroxy-7,12-dimethylbenz[a]anthracene (CHEBI:82593) is a phenanthrenes (CHEBI:25961) |
| Synonym | Source |
|---|---|
| trans-DMBA-5,6-dihydrodiol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C19607 | KEGG COMPOUND |
| HMDB0060519 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:16644-15-8 | KEGG COMPOUND |