EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N3O8 |
| Net Charge | 0 |
| Average Mass | 385.373 |
| Monoisotopic Mass | 385.14851 |
| SMILES | CN(CCCC(O)c1ccc[n+]([C@@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)c1)N=O |
| InChI | InChI=1S/C16H23N3O8/c1-18(17-26)6-3-5-10(20)9-4-2-7-19(8-9)15-13(23)11(21)12(22)14(27-15)16(24)25/h2,4,7-8,10-15,20-23H,3,5-6H2,1H3/t10?,11-,12-,13+,14-,15+/m0/s1 |
| InChIKey | VSVYJUYJFLYYSI-UKOUFMKDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NNAL-N-glucuronide (CHEBI:82592) is a amino acid (CHEBI:33709) |
| NNAL-N-glucuronide (CHEBI:82592) is a oxacycle (CHEBI:38104) |
| Manual Xrefs | Databases |
|---|---|
| C19606 | KEGG COMPOUND |