EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O |
| Net Charge | 0 |
| Average Mass | 272.347 |
| Monoisotopic Mass | 272.12012 |
| SMILES | Cc1c2ccccc2c(CO)c2ccc3ccccc3c12 |
| InChI | InChI=1S/C20H16O/c1-13-15-7-4-5-9-17(15)19(12-21)18-11-10-14-6-2-3-8-16(14)20(13)18/h2-11,21H,12H2,1H3 |
| InChIKey | JCBBZYDVQJQMMB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Hydroxymethyl-12-methylbenz[a]anthracene (CHEBI:82559) is a phenanthrenes (CHEBI:25961) |
| Synonym | Source |
|---|---|
| 12-Methylbenz[a]anthracene-7-methanol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C19561 | KEGG COMPOUND |
| HMDB0060419 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:568-75-2 | KEGG COMPOUND |