EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O3 |
| Net Charge | 0 |
| Average Mass | 306.361 |
| Monoisotopic Mass | 306.12559 |
| SMILES | Cc1c2ccccc2c(C)c2c3c(ccc12)[C@H](O)[C@@H](O)[C@H]1O[C@@H]31 |
| InChI | InChI=1S/C20H18O3/c1-9-11-5-3-4-6-12(11)10(2)15-13(9)7-8-14-16(15)19-20(23-19)18(22)17(14)21/h3-8,17-22H,1-2H3/t17-,18+,19-,20+/m0/s1 |
| InChIKey | SZIWZGXOWBSPTO-ZGXWSNOMSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1aalpha,2beta,3alpha,11calpha)-1a,2,3,11c-Tetrahydro-6,11-dimethylbenzo[6,7]phenanthro[3,4-b]oxirene-2,3-diol (CHEBI:82558) is a phenanthrol (CHEBI:25962) |
| Manual Xrefs | Databases |
|---|---|
| C19559 | KEGG COMPOUND |
| HMDB0062223 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:86941-58-4 | KEGG COMPOUND |