EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O8S2 |
| Net Charge | 0 |
| Average Mass | 278.304 |
| Monoisotopic Mass | 278.01301 |
| SMILES | CS(=O)(=O)OC[C@H](O)[C@@H](O)COS(C)(=O)=O |
| InChI | InChI=1S/C6H14O8S2/c1-15(9,10)13-3-5(7)6(8)4-14-16(2,11)12/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | YCPOZVAOBBQLRI-WDSKDSINSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Treosulfan (CHEBI:82557) has role antineoplastic agent (CHEBI:35610) |
| Treosulfan (CHEBI:82557) is a methanesulfonate ester (CHEBI:25223) |
| INN | Source |
|---|---|
| treosulfano | WHO MedNet |
| Synonyms | Source |
|---|---|
| L-threitol 1,4-dimethanesulfonate | ChEMBL |
| NSC-39069 | ChEMBL |
| threosulphan | DrugCentral |
| Treosulfan | ChEMBL |
| treosulphan | DrugCentral |
| tresulfan | DrugCentral |
| Brand Names | Source |
|---|---|
| Grafapex | ChEMBL |
| Graftrevo | ChEMBL |
| Kepcondi | ChEMBL |
| Ovastat | ChEMBL |
| Trecondi | ChEMBL |
| Trecondyv | ChEMBL |
| Citations |
|---|