EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O2 |
| Net Charge | 0 |
| Average Mass | 290.362 |
| Monoisotopic Mass | 290.13068 |
| SMILES | Cc1c2ccccc2c(C)c2c3c(ccc12)[C@H](O)[C@@H](O)C=C3 |
| InChI | InChI=1S/C20H18O2/c1-11-13-5-3-4-6-14(13)12(2)19-15(11)7-8-17-16(19)9-10-18(21)20(17)22/h3-10,18,20-22H,1-2H3/t18-,20-/m0/s1 |
| InChIKey | YZIIKMBFHLJAFT-ICSRJNTNSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-3,4-Dihydro-3,4-dihydroxy-7,12-dimethylbenz[a]anthracene (CHEBI:82518) is a phenanthrol (CHEBI:25962) |
| Synonym | Source |
|---|---|
| trans-DMBA-3,4-dihydrodiol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C19490 | KEGG COMPOUND |
| HMDB0060517 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:68162-13-0 | KEGG COMPOUND |