EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29NO6 |
| Net Charge | 0 |
| Average Mass | 451.519 |
| Monoisotopic Mass | 451.19949 |
| SMILES | COc1c(N)c(O)c(CC=C(C)C)c(-c2coc3cc(O)cc(O)c3c2=O)c1CC=C(C)C |
| InChI | InChI=1S/C26H29NO6/c1-13(2)6-8-16-21(17(9-7-14(3)4)26(32-5)23(27)25(16)31)18-12-33-20-11-15(28)10-19(29)22(20)24(18)30/h6-7,10-12,28-29,31H,8-9,27H2,1-5H3 |
| InChIKey | FZVQFYVMVHEMPU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piscerythramine (CHEBI:8251) has functional parent isoflavone (CHEBI:18220) |
| piscerythramine (CHEBI:8251) has role plant metabolite (CHEBI:76924) |
| piscerythramine (CHEBI:8251) is a hydroxyisoflavone (CHEBI:38755) |
| piscerythramine (CHEBI:8251) is a methoxyisoflavone (CHEBI:38756) |
| piscerythramine (CHEBI:8251) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 3-[4-amino-3-hydroxy-5-methoxy-2,6-bis(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-4H-1-benzopyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| C00002561 | KNApSAcK |
| C10518 | KEGG COMPOUND |
| LMPK12050157 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4339243 | Reaxys |
| CAS:132923-36-5 | KEGG COMPOUND |