EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H11NO2 |
| Net Charge | 0 |
| Average Mass | 297.313 |
| Monoisotopic Mass | 297.07898 |
| SMILES | O=[N+]([O-])c1c2ccccc2c2ccc3cccc4ccc1c2c43 |
| InChI | InChI=1S/C20H11NO2/c22-21(23)20-16-7-2-1-6-14(16)15-10-8-12-4-3-5-13-9-11-17(20)19(15)18(12)13/h1-11H |
| InChIKey | NMMAFYSZGOFZCM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Nitrobenzo[a]pyrene (CHEBI:82503) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| Manual Xrefs | Databases |
|---|---|
| C19472 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:63041-90-7 | KEGG COMPOUND |