EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H11NO2 |
| Net Charge | 0 |
| Average Mass | 273.291 |
| Monoisotopic Mass | 273.07898 |
| SMILES | O=[N+]([O-])c1c2ccccc2cc2c1ccc1ccccc12 |
| InChI | InChI=1S/C18H11NO2/c20-19(21)18-15-8-4-2-6-13(15)11-17-14-7-3-1-5-12(14)9-10-16(17)18/h1-11H |
| InChIKey | KOPVBVBUIYTJBG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Nitrobenz[a]anthracene (CHEBI:82502) is a phenanthrenes (CHEBI:25961) |
| Manual Xrefs | Databases |
|---|---|
| C19471 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:20268-51-3 | KEGG COMPOUND |