EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N5O2 |
| Net Charge | 0 |
| Average Mass | 351.410 |
| Monoisotopic Mass | 351.16952 |
| SMILES | CN1CCN(CC(=O)N2c3ccccc3C(=O)Nc3cccnc32)CC1 |
| InChI | InChI=1S/C19H21N5O2/c1-22-9-11-23(12-10-22)13-17(25)24-16-7-3-2-5-14(16)19(26)21-15-6-4-8-20-18(15)24/h2-8H,9-13H2,1H3,(H,21,26) |
| InChIKey | RMHMFHUVIITRHF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirenzepine (CHEBI:8247) has role anti-ulcer drug (CHEBI:49201) |
| pirenzepine (CHEBI:8247) has role antispasmodic drug (CHEBI:53784) |
| pirenzepine (CHEBI:8247) has role muscarinic antagonist (CHEBI:48876) |
| pirenzepine (CHEBI:8247) is a pyridobenzodiazepine (CHEBI:71329) |
| Incoming Relation(s) |
| pirenzepine hydrochloride (CHEBI:32014) has part pirenzepine (CHEBI:8247) |
| IUPAC Name |
|---|
| 11-[(4-methylpiperazin-1-yl)acetyl]-5,11-dihydro-6H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| INNs | Source |
|---|---|
| pirenzepina | ChemIDplus |
| pirenzepine | ChemIDplus |
| pirenzépine | ChEBI |
| pirenzepinum | ChemIDplus |
| Synonym | Source |
|---|---|
| 11-((4-Methyl-1-piperazinyl)acetyl)-5,11-dihydro-6H-pyrido(2,3-b)(1,4)benzodiazepin-6-one | ChemIDplus |