EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O.C4H6O4 |
| Net Charge | 0 |
| Average Mass | 388.464 |
| Monoisotopic Mass | 388.19982 |
| SMILES | CN(C)CCOC(C)(c1ccccc1)c1ccccn1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C17H22N2O.C4H6O4/c1-17(20-14-13-19(2)3,15-9-5-4-6-10-15)16-11-7-8-12-18-16;5-3(6)1-2-4(7)8/h4-12H,13-14H2,1-3H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | KBAUFVUYFNWQFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Doxylamine succinate (CHEBI:82461) has role antiinfective agent (CHEBI:35441) |
| Doxylamine succinate (CHEBI:82461) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Alsodorm | ChEMBL |
| Donormil | ChEMBL |
| Donormyl | ChEMBL |
| Dormidina | ChEMBL |
| Doxylamine hydrogen succinate | ChEMBL |
| Gittalun | ChEMBL |
| Brand Names | Source |
|---|---|
| Decapryn | ChEMBL |
| Doxylamine succinate component of bendectin | ChEMBL |
| Doxylamine succinate component of bonjesta | ChEMBL |
| Doxylamine succinate component of diclectin | ChEMBL |
| Doxylamine succinate component of diclegis | ChEMBL |
| Doxy-sleep-aid | ChEMBL |
| Citations |
|---|