EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2S |
| Net Charge | 0 |
| Average Mass | 132.232 |
| Monoisotopic Mass | 132.07212 |
| SMILES | CCNC(=S)NCC |
| InChI | InChI=1S/C5H12N2S/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8) |
| InChIKey | FLVIGYVXZHLUHP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N'-diethylthiourea (CHEBI:82448) has role allergen (CHEBI:50904) |
| N,N'-diethylthiourea (CHEBI:82448) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| N,N'-diethylthiourea |
| Synonyms | Source |
|---|---|
| 1,3-Diethylthiourea | ChemIDplus |
| N,N-Diethyl-2-thiourea | ChemIDplus |
| Thiate H | ChemIDplus |
| 1,3-Diethyl-2-thiourea | ChemIDplus |
| Pennzone E | ChemIDplus |
| N,N'-Diethylthiocarbamide | ChemIDplus |
| Citations |
|---|