EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H14 |
| Net Charge | 0 |
| Average Mass | 302.376 |
| Monoisotopic Mass | 302.10955 |
| SMILES | c1ccc2c(c1)-c1cc3ccccc3c3cc4ccccc4c-2c13 |
| InChI | InChI=1S/C24H14/c1-3-9-17-15(7-1)13-22-19-11-5-6-12-20(19)23-18-10-4-2-8-16(18)14-21(17)24(22)23/h1-14H |
| InChIKey | JHOWUOKQHJHGMU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dibenzo[a,e]fluoranthene (CHEBI:82439) is a phenanthrenes (CHEBI:25961) |
| Synonym | Source |
|---|---|
| 2,3,5,6-Dibenzofluoranthene | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C19390 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:5385-75-1 | KEGG COMPOUND |