EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10N2O7S2.2Na |
| Net Charge | 0 |
| Average Mass | 452.377 |
| Monoisotopic Mass | 451.97248 |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)[O-])c2c(/N=N/c3ccccc3)c(O)ccc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C16H12N2O7S2.2Na/c19-13-7-6-10-8-12(26(20,21)22)9-14(27(23,24)25)15(10)16(13)18-17-11-4-2-1-3-5-11;;/h1-9,19H,(H,20,21,22)(H,23,24,25);;/q;2*+1/p-2/b18-17+;; |
| InChIKey | HSXUHWZMNJHFRV-QIKYXUGXSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orange G (CHEBI:82427) has part 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonate (CHEBI:87093) |
| orange G (CHEBI:82427) has role histological dye (CHEBI:77178) |
| orange G (CHEBI:82427) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 7-hydroxy-8-[(E)-phenyldiazenyl]naphthalene-1,3-disulfonate |
| Synonyms | Source |
|---|---|
| acid orange 10 | ChEBI |
| C.I. 16230 | ChEBI |
| C.I. Acid Orange No. 10 | ChemIDplus |
| C.I. Food Orange 4 | ChemIDplus |
| C.I. Acid Orange 10, disodium salt | ChemIDplus |
| C.I. Acid Orange 10 | ChemIDplus |
| Citations |
|---|