EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O4 |
| Net Charge | 0 |
| Average Mass | 242.230 |
| Monoisotopic Mass | 242.05791 |
| SMILES | O=C(OOC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O4/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H |
| InChIKey | OMPJBNCRMGITSC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Benzoyl peroxide (CHEBI:82405) has role antiinfective agent (CHEBI:35441) |
| Benzoyl peroxide (CHEBI:82405) is a carbonyl compound (CHEBI:36586) |
| Synonyms | Source |
|---|---|
| acetoxyl | DrugCentral |
| Anhydrous benzoyl peroxide | ChEMBL |
| benoxyl | DrugCentral |
| benzoperoxide | DrugCentral |
| Benzoylis peroxidum cum aqua | ChEMBL |
| Benzoyl peroxide | ChEMBL |
| Brand Names | Source |
|---|---|
| Acetoxyl 2.5 | ChEMBL |
| Acetoxyl 5 | ChEMBL |
| Acnecide | ChEMBL |
| Acnecide 10 | ChEMBL |
| Acnegel | ChEMBL |
| Acnegel fte | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1847 | VSDB |
| 328 | DrugCentral |
| C19346 | KEGG COMPOUND |
| D03093 | KEGG DRUG |
| HMDB0032040 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:94-36-0 | KEGG COMPOUND |
| Citations |
|---|