EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8240 - piperonal
| Formula | C8H6O3 |
| Net Charge | 0 |
| Average Mass | 150.133 |
| Monoisotopic Mass | 150.03169 |
| SMILES | [H]C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H6O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-4H,5H2 |
| InChIKey | SATCULPHIDQDRE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. insect repellent An insecticide that acts as a repellent to insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piperonal (CHEBI:8240) has role fragrance (CHEBI:48318) |
| piperonal (CHEBI:8240) has role insect repellent (CHEBI:71692) |
| piperonal (CHEBI:8240) has role plant metabolite (CHEBI:76924) |
| piperonal (CHEBI:8240) is a arenecarbaldehyde (CHEBI:33855) |
| piperonal (CHEBI:8240) is a benzodioxoles (CHEBI:38298) |
| IUPAC Name |
|---|
| 1,3-benzodioxole-5-carbaldehyde |
| Synonyms | Source |
|---|---|
| Piperonal | KEGG COMPOUND |
| 1,3-benzodioxole-5-carboxaldehyde | NIST Chemistry WebBook |
| piperonaldehyde | NIST Chemistry WebBook |
| piperonylaldehyde | NIST Chemistry WebBook |
| 3,4-(methylenedioxy)benzaldehyde | NIST Chemistry WebBook |
| 3,4-dihydroxybenzaldehyde methylene ketal | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| piperonal | UniProt |
| Citations |
|---|