EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H12 |
| Net Charge | 0 |
| Average Mass | 276.338 |
| Monoisotopic Mass | 276.09390 |
| SMILES | c1cc2ccc3cc4cccc5ccc6cc(c1)c2c3c6c54 |
| InChI | InChI=1S/C22H12/c1-3-13-7-9-18-12-16-6-2-4-14-8-10-17-11-15(5-1)19(13)21(18)22(17)20(14)16/h1-12H |
| InChIKey | YFIJJNAKSZUOLT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anthanthrene (CHEBI:82389) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| Synonym | Source |
|---|---|
| Dibenzo[cd,jk]pyrene | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C19327 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:191-26-4 | KEGG COMPOUND |