EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82388 - p-anisidine
| Formula | C7H9NO |
| Net Charge | 0 |
| Average Mass | 123.155 |
| Monoisotopic Mass | 123.06841 |
| SMILES | COc1ccc(N)cc1 |
| InChI | InChI=1S/C7H9NO/c1-9-7-4-2-6(8)3-5-7/h2-5H,8H2,1H3 |
| InChIKey | BHAAPTBBJKJZER-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| Application: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-anisidine (CHEBI:82388) has role genotoxin (CHEBI:50902) |
| p-anisidine (CHEBI:82388) has role reagent (CHEBI:33893) |
| p-anisidine (CHEBI:82388) is a methoxybenzenes (CHEBI:51683) |
| p-anisidine (CHEBI:82388) is a primary amino compound (CHEBI:50994) |
| p-anisidine (CHEBI:82388) is a substituted aniline (CHEBI:48975) |
| Incoming Relation(s) |
| methacetin (CHEBI:139354) has functional parent p-anisidine (CHEBI:82388) |
| IUPAC Name |
|---|
| 4-methoxyaniline |
| Synonyms | Source |
|---|---|
| 1-amino-4-methoxybenzene | ChemIDplus |
| 4-aminoanisole | ChemIDplus |
| 4-anisidine | ChemIDplus |
| 4-methoxybenzenamine | NIST Chemistry WebBook |
| 4-methoxybenzeneamine | ChemIDplus |
| para-anisidine | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-methoxyaniline | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C19326 | KEGG COMPOUND |
| FDB000339 | FooDB |
| HMDB0029300 | HMDB |
| P-Anisidine | Wikipedia |
| Citations |
|---|