EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N2O7S2.2Na |
| Net Charge | 0 |
| Average Mass | 480.431 |
| Monoisotopic Mass | 480.00378 |
| SMILES | Cc1ccc(N=Nc2c(O)c(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])ccc23)c(C)c1.[Na+].[Na+] |
| InChI | InChI=1S/C18H16N2O7S2.2Na/c1-10-3-6-15(11(2)7-10)19-20-17-14-5-4-13(28(22,23)24)8-12(14)9-16(18(17)21)29(25,26)27;;/h3-9,21H,1-2H3,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2 |
| InChIKey | YJVBLROMQZEFPA-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Roles: | cardiotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the heart and cardiomyocytes. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acid red 26 (CHEBI:82369) has part 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonate (CHEBI:87105) |
| acid red 26 (CHEBI:82369) has role carcinogenic agent (CHEBI:50903) |
| acid red 26 (CHEBI:82369) has role cardiotoxic agent (CHEBI:50912) |
| acid red 26 (CHEBI:82369) has role histological dye (CHEBI:77178) |
| acid red 26 (CHEBI:82369) is a organic sodium salt (CHEBI:38700) |
| Synonyms | Source |
|---|---|
| C.I. 16150 | ChEBI |
| CI F Food Red 5 | ChemIDplus |
| disodium 4-[(2,4-dimethylphenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonate | ChEBI |
| ponceau 2R | ChEBI |
| ponceau de xylidine | ChEBI |
| Ponceau Red R | ChemIDplus |
| Citations |
|---|