EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12 |
| Net Charge | 0 |
| Average Mass | 228.294 |
| Monoisotopic Mass | 228.09390 |
| SMILES | c1ccc2c(c1)ccc1ccc3ccccc3c12 |
| InChI | InChI=1S/C18H12/c1-3-7-16-13(5-1)9-11-15-12-10-14-6-2-4-8-17(14)18(15)16/h1-12H |
| InChIKey | TUAHORSUHVUKBD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzo[c]phenanthrene (CHEBI:82292) is a ortho-fused polycyclic arene (CHEBI:35296) |
| benzo[c]phenanthrene (CHEBI:82292) is a benzenoid aromatic compound (CHEBI:33836) |
| Incoming Relation(s) |
| hydroxybenzo[c]phenanthrene (CHEBI:132444) has parent hydride benzo[c]phenanthrene (CHEBI:82292) |
| IUPAC Name |
|---|
| benzo[c]phenanthrene |
| Synonyms | Source |
|---|---|
| 3,4-benzophenanthrene | ChemIDplus |
| 3,4-Benzphenanthrene | KEGG COMPOUND |
| BcPh | ChEBI |
| benzo-3,4-phenanthrene | NIST Chemistry WebBook |
| benzo(c)phenanthrene | ChemIDplus |
| tetrahelicene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Benzo(c)phenanthrene | Wikipedia |
| C19197 | KEGG COMPOUND |
| Citations |
|---|