EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O3S.HCl |
| Net Charge | 0 |
| Average Mass | 392.908 |
| Monoisotopic Mass | 392.09614 |
| SMILES | CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1.Cl |
| InChI | InChI=1S/C19H20N2O3S.ClH/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17;/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23);1H |
| InChIKey | GHUUBYQTCDQWRA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pioglitazone hydrochloride (CHEBI:8229) has role antidepressant (CHEBI:35469) |
| Pioglitazone hydrochloride (CHEBI:8229) has role antineoplastic agent (CHEBI:35610) |
| Pioglitazone hydrochloride (CHEBI:8229) has role hypoglycemic agent (CHEBI:35526) |
| Pioglitazone hydrochloride (CHEBI:8229) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Actos (TN) | KEGG COMPOUND |
| NSC-758876 | ChEMBL |
| Pioglitazone (as hydrochloride) | ChEMBL |
| Pioglitazone hcl | ChEMBL |
| Pioglitazone hydrochloride | KEGG COMPOUND |
| Piomed | ChEMBL |
| Brand Names | Source |
|---|---|
| Actos | ChEMBL |
| Diabiom | ChEMBL |
| Glidipion | ChEMBL |
| Glidipion (previously pioglitazone actavis group) | ChEMBL |
| Glizofar | ChEMBL |
| Paglitaz | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00945 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:112529-15-4 | KEGG COMPOUND |
| Citations |
|---|