EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO |
| Net Charge | 0 |
| Average Mass | 123.155 |
| Monoisotopic Mass | 123.06841 |
| SMILES | COc1ccccc1N |
| InChI | InChI=1S/C7H9NO/c1-9-7-5-3-2-4-6(7)8/h2-5H,8H2,1H3 |
| InChIKey | VMPITZXILSNTON-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| Application: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| o-anisidine (CHEBI:82288) has role genotoxin (CHEBI:50902) |
| o-anisidine (CHEBI:82288) has role reagent (CHEBI:33893) |
| o-anisidine (CHEBI:82288) is a monomethoxybenzene (CHEBI:25235) |
| o-anisidine (CHEBI:82288) is a primary amino compound (CHEBI:50994) |
| o-anisidine (CHEBI:82288) is a substituted aniline (CHEBI:48975) |
| Synonyms | Source |
|---|---|
| 1-amino-2-methoxybenzene | ChemIDplus |
| 2-aminoanisole | ChemIDplus |
| 2-anisidine | ChemIDplus |
| 2-methoxy-1-aminobenzene | ChemIDplus |
| 2-methoxybenzenamine | ChemIDplus |
| o-aminoanisole | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 2-methoxyaniline | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C19191 | KEGG COMPOUND |
| O-Anisidine | Wikipedia |
| Citations |
|---|