EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15Br6O4P |
| Net Charge | 0 |
| Average Mass | 697.613 |
| Monoisotopic Mass | 691.58082 |
| SMILES | O=P(OCC(Br)CBr)(OCC(Br)CBr)OCC(Br)CBr |
| InChI | InChI=1S/C9H15Br6O4P/c10-1-7(13)4-17-20(16,18-5-8(14)2-11)19-6-9(15)3-12/h7-9H,1-6H2 |
| InChIKey | PQYJRMFWJJONBO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | flame retardant Any compound that is added to manufactured materials to inhibit, suppress, or delay the production of flames and so prevent the spread of fire. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tris(2,3-dibromopropyl) phosphate (CHEBI:82282) has role carcinogenic agent (CHEBI:50903) |
| tris(2,3-dibromopropyl) phosphate (CHEBI:82282) has role mutagen (CHEBI:25435) |
| tris(2,3-dibromopropyl) phosphate (CHEBI:82282) is a brominated flame retardant (CHEBI:172368) |
| tris(2,3-dibromopropyl) phosphate (CHEBI:82282) is a trialkyl phosphate (CHEBI:37562) |
| Synonyms | Source |
|---|---|
| phosphoric acid tris(2,3-dibromopropyl) ester | ChEBI |
| TDBPP | NIST Chemistry WebBook |
| tris | NIST Chemistry WebBook |
| tris-BP | NIST Chemistry WebBook |
| tris (flame retardant) | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C19182 | KEGG COMPOUND |
| Tris(2,3-dibromopropyl)_phosphate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:126-72-7 | NIST Chemistry WebBook |
| Citations |
|---|