EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8228 - pioglitazone
| Formula | C19H20N2O3S |
| Net Charge | 0 |
| Average Mass | 356.447 |
| Monoisotopic Mass | 356.11946 |
| SMILES | CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23) |
| InChIKey | HYAFETHFCAUJAY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor An EC 6.2.1.* (acid-thiol ligase) inhibitor that interferes with the action of a long-chain-fatty-acid—CoA ligase (EC 6.2.1.3). EC 2.7.1.33 (pantothenate kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of pantothenate kinase (EC 2.7.1.33). insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). PPARgamma agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-γ. ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. cardioprotective agent Any protective agent that is able to prevent damage to the heart. insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). hypoglycemic agent A drug which lowers the blood glucose level. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pioglitazone (CHEBI:8228) has role antidepressant (CHEBI:35469) |
| pioglitazone (CHEBI:8228) has role cardioprotective agent (CHEBI:77307) |
| pioglitazone (CHEBI:8228) has role EC 2.7.1.33 (pantothenate kinase) inhibitor (CHEBI:77194) |
| pioglitazone (CHEBI:8228) has role EC 6.2.1.3 (long-chain-fatty-acid—CoA ligase) inhibitor (CHEBI:83157) |
| pioglitazone (CHEBI:8228) has role ferroptosis inhibitor (CHEBI:173084) |
| pioglitazone (CHEBI:8228) has role geroprotector (CHEBI:176497) |
| pioglitazone (CHEBI:8228) has role hypoglycemic agent (CHEBI:35526) |
| pioglitazone (CHEBI:8228) has role insulin-sensitizing drug (CHEBI:50864) |
| pioglitazone (CHEBI:8228) has role PPARγ agonist (CHEBI:71554) |
| pioglitazone (CHEBI:8228) has role xenobiotic (CHEBI:35703) |
| pioglitazone (CHEBI:8228) is a aromatic ether (CHEBI:35618) |
| pioglitazone (CHEBI:8228) is a pyridines (CHEBI:26421) |
| pioglitazone (CHEBI:8228) is a thiazolidinediones (CHEBI:50990) |
| Incoming Relation(s) |
| hydroxypioglitazone (CHEBI:82937) has functional parent pioglitazone (CHEBI:8228) |
| IUPAC Name |
|---|
| 5-{4-[2-(5-ethylpyridin-2-yl)ethoxy]benzyl}-1,3-thiazolidine-2,4-dione |
| INNs | Source |
|---|---|
| pioglitazona | ChemIDplus |
| pioglitazone | ChemIDplus |
| pioglitazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-5-((4-(2-(5-ethyl-2-pyridinyl)ethoxy)phenyl)methyl)-2,4-thiazolidinedione | ChemIDplus |
| Pioglitazone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2179 | DrugCentral |
| 4663 | ChemSpider |
| C07675 | KEGG COMPOUND |
| D08378 | KEGG DRUG |
| DB01132 | DrugBank |
| EP193256 | Patent |
| HMDB0015264 | HMDB |
| LSM-1592 | LINCS |
| Pioglitazone | Wikipedia |
| US4687777 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3595485 | Reaxys |
| CAS:111025-46-8 | KEGG COMPOUND |
| CAS:111025-46-8 | ChemIDplus |
| Citations |
|---|