EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O3S |
| Net Charge | 0 |
| Average Mass | 356.447 |
| Monoisotopic Mass | 356.11946 |
| SMILES | CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23) |
| InChIKey | HYAFETHFCAUJAY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.33 (pantothenate kinase) inhibitor An EC 2.7.1.* (phosphotransferases with an alcohol group as acceptor) inhibitor that interferes with the action of pantothenate kinase (EC 2.7.1.33). ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. PPARgamma agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-γ. insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor An EC 6.2.1.* (acid-thiol ligase) inhibitor that interferes with the action of a long-chain-fatty-acid—CoA ligase (EC 6.2.1.3). |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. hypoglycemic agent A drug which lowers the blood glucose level. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pioglitazone (CHEBI:8228) has role antidepressant (CHEBI:35469) |
| pioglitazone (CHEBI:8228) has role cardioprotective agent (CHEBI:77307) |
| pioglitazone (CHEBI:8228) has role EC 2.7.1.33 (pantothenate kinase) inhibitor (CHEBI:77194) |
| pioglitazone (CHEBI:8228) has role EC 6.2.1.3 (long-chain-fatty-acid—CoA ligase) inhibitor (CHEBI:83157) |
| pioglitazone (CHEBI:8228) has role ferroptosis inhibitor (CHEBI:173084) |
| pioglitazone (CHEBI:8228) has role geroprotector (CHEBI:176497) |
| pioglitazone (CHEBI:8228) has role hypoglycemic agent (CHEBI:35526) |
| pioglitazone (CHEBI:8228) has role insulin-sensitizing drug (CHEBI:50864) |
| pioglitazone (CHEBI:8228) has role PPARγ agonist (CHEBI:71554) |
| pioglitazone (CHEBI:8228) has role xenobiotic (CHEBI:35703) |
| pioglitazone (CHEBI:8228) is a aromatic ether (CHEBI:35618) |
| pioglitazone (CHEBI:8228) is a pyridines (CHEBI:26421) |
| pioglitazone (CHEBI:8228) is a thiazolidinediones (CHEBI:50990) |
| Incoming Relation(s) |
| hydroxypioglitazone (CHEBI:82937) has functional parent pioglitazone (CHEBI:8228) |
| IUPAC Name |
|---|
| 5-{4-[2-(5-ethylpyridin-2-yl)ethoxy]benzyl}-1,3-thiazolidine-2,4-dione |
| INNs | Source |
|---|---|
| pioglitazona | ChemIDplus |
| pioglitazone | ChemIDplus |
| pioglitazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-5-((4-(2-(5-ethyl-2-pyridinyl)ethoxy)phenyl)methyl)-2,4-thiazolidinedione | ChemIDplus |
| Pioglitazone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2179 | DrugCentral |
| 4663 | ChemSpider |
| C07675 | KEGG COMPOUND |
| D08378 | KEGG DRUG |
| DB01132 | DrugBank |
| EP193256 | Patent |
| HMDB0015264 | HMDB |
| LSM-1592 | LINCS |
| Pioglitazone | Wikipedia |
| US4687777 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3595485 | Reaxys |
| CAS:111025-46-8 | KEGG COMPOUND |
| CAS:111025-46-8 | ChemIDplus |
| Citations |
|---|