EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5ClO |
| Net Charge | 0 |
| Average Mass | 140.569 |
| Monoisotopic Mass | 140.00289 |
| SMILES | O=C(Cl)c1ccccc1 |
| InChI | InChI=1S/C7H5ClO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| InChIKey | PASDCCFISLVPSO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzoyl chloride (CHEBI:82275) has functional parent benzoic acid (CHEBI:30746) |
| benzoyl chloride (CHEBI:82275) has role carcinogenic agent (CHEBI:50903) |
| benzoyl chloride (CHEBI:82275) is a acyl chloride (CHEBI:36687) |
| benzoyl chloride (CHEBI:82275) is a benzenes (CHEBI:22712) |
| Incoming Relation(s) |
| 4-cyanobenzoyl chloride (CHEBI:184302) has functional parent benzoyl chloride (CHEBI:82275) |
| IUPAC Name |
|---|
| benzoyl chloride |
| Synonyms | Source |
|---|---|
| α-chlorobenzaldehyde | ChemIDplus |
| benzenecarbonyl chloride | ChemIDplus |
| benzoic acid chloride | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C19168 | KEGG COMPOUND |
| Benzoyl_chloride | Wikipedia |
| Citations |
|---|