EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | CCCOC(=O)C1c2cc3c(cc2CC(C)C1C(=O)OCCC)OCO3 |
| InChI | InChI=1S/C20H26O6/c1-4-6-23-19(21)17-12(3)8-13-9-15-16(26-11-25-15)10-14(13)18(17)20(22)24-7-5-2/h9-10,12,17-18H,4-8,11H2,1-3H3 |
| InChIKey | UEKQGZQLUMSLNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Propyl isome (CHEBI:82265) is a naphthoic acid (CHEBI:25483) |
| Synonym | Source |
|---|---|
| 1,2,3,4-Tetrahydro-3-methyl-6,7-methylenebisoxynaphthalene-1,2-dicarboxylic acid dipropyl | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C19145 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:83-59-0 | KEGG COMPOUND |