EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:82263 - Dibutyl succinate
| Formula | C12H22O4 |
| Net Charge | 0 |
| Average Mass | 230.304 |
| Monoisotopic Mass | 230.15181 |
| SMILES | CCCCOC(=O)CCC(=O)OCCCC |
| InChI | InChI=1S/C12H22O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h3-10H2,1-2H3 |
| InChIKey | YUXIBTJKHLUKBD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparasitic agent A substance used to treat or prevent parasitic infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dibutyl succinate (CHEBI:82263) has role antiparasitic agent (CHEBI:35442) |
| Dibutyl succinate (CHEBI:82263) is a dicarboxylic acids and O-substituted derivatives (CHEBI:131927) |
| Dibutyl succinate (CHEBI:82263) is a diester (CHEBI:51307) |
| Synonyms | Source |
|---|---|
| dibutyl succinate | DrugCentral |
| dibutylsuccinate | ChEMBL |
| Dibutylsuccinate | ChEMBL |
| NSC-1502 | ChEMBL |