EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O7 |
| Net Charge | 0 |
| Average Mass | 316.265 |
| Monoisotopic Mass | 316.05830 |
| SMILES | Cc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(O)c(=O)c2c1O |
| InChI | InChI=1S/C16H12O7/c1-6-9(18)5-11-12(13(6)20)14(21)15(22)16(23-11)7-2-3-8(17)10(19)4-7/h2-5,17-20,22H,1H3 |
| InChIKey | DTFXGVGIKNSCQQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinoquercetin (CHEBI:8224) has functional parent quercetin (CHEBI:16243) |
| pinoquercetin (CHEBI:8224) has role metabolite (CHEBI:25212) |
| pinoquercetin (CHEBI:8224) has role plant metabolite (CHEBI:76924) |
| pinoquercetin (CHEBI:8224) is a 7-hydroxyflavonol (CHEBI:52267) |
| pinoquercetin (CHEBI:8224) is a pentahydroxyflavone (CHEBI:25883) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methyl-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 6-C-Methylquercetin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00004895 | KNApSAcK |
| C10120 | KEGG COMPOUND |
| LMPK12112292 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:324756 | Reaxys |
| CAS:491-49-6 | KEGG COMPOUND |