EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12ClN5O2 |
| Net Charge | 0 |
| Average Mass | 245.670 |
| Monoisotopic Mass | 245.06795 |
| SMILES | CC(C)Nc1nc(Cl)nc(NCC(=O)O)n1 |
| InChI | InChI=1S/C8H12ClN5O2/c1-4(2)11-8-13-6(9)12-7(14-8)10-3-5(15)16/h4H,3H2,1-2H3,(H,15,16)(H2,10,11,12,13,14) |
| InChIKey | XCXCBWSRDOSZRU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Proglinazine (CHEBI:82227) is a non-proteinogenic α-amino acid (CHEBI:83925) |