EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10ClN5O2 |
| Net Charge | 0 |
| Average Mass | 231.643 |
| Monoisotopic Mass | 231.05230 |
| SMILES | CCNc1nc(Cl)nc(NCC(=O)O)n1 |
| InChI | InChI=1S/C7H10ClN5O2/c1-2-9-6-11-5(8)12-7(13-6)10-3-4(14)15/h2-3H2,1H3,(H,14,15)(H2,9,10,11,12,13) |
| InChIKey | IAUFMJOLSFEAIJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eglinazine (CHEBI:82224) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Manual Xrefs | Databases |
|---|---|
| C19102 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:68228-19-3 | KEGG COMPOUND |