EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82220 - atraton
| Formula | C9H17N5O |
| Net Charge | 0 |
| Average Mass | 211.269 |
| Monoisotopic Mass | 211.14331 |
| SMILES | CCNc1nc(NC(C)C)nc(OC)n1 |
| InChI | InChI=1S/C9H17N5O/c1-5-10-7-12-8(11-6(2)3)14-9(13-7)15-4/h6H,5H2,1-4H3,(H2,10,11,12,13,14) |
| InChIKey | PXWUKZGIHQRDHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atraton (CHEBI:82220) has role agrochemical (CHEBI:33286) |
| atraton (CHEBI:82220) has role environmental contaminant (CHEBI:78298) |
| atraton (CHEBI:82220) has role herbicide (CHEBI:24527) |
| atraton (CHEBI:82220) has role xenobiotic (CHEBI:35703) |
| atraton (CHEBI:82220) is a diamino-1,3,5-triazine (CHEBI:38170) |
| atraton (CHEBI:82220) is a methoxy-1,3,5-triazine (CHEBI:38177) |
| IUPAC Name |
|---|
| N-ethyl-6-methoxy-N'-(propan-2-yl)-1,3,5-triazine-2,4-diamine |
| Synonyms | Source |
|---|---|
| 2-Methoxy-4-ethylamino-6-isopropylamino-s-triazine | ChemIDplus |
| 2-Methoxy-4-isopropylamino-6-ethylamino-s-triazine | ChemIDplus |
| Citations |
|---|