EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O13 |
| Net Charge | 0 |
| Average Mass | 564.540 |
| Monoisotopic Mass | 564.18429 |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2[C@H](Oc3cc(O)c4c(c3)O[C@H](c3ccccc3)CC4=O)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H32O13/c1-11-20(31)22(33)24(35)26(36-11)40-25-23(34)21(32)18(10-28)39-27(25)37-13-7-14(29)19-15(30)9-16(38-17(19)8-13)12-5-3-2-4-6-12/h2-8,11,16,18,20-29,31-35H,9-10H2,1H3/t11-,16-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | UVPBNPUZWAOBQX-AFUJZTQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Litchi chinensis (ncbitaxon:151069) | seed (BTO:0001226) | PubMed (21287989) | |
| Sparattosperma leucanthum (ncbitaxon:429671) | leaf (BTO:0000713) | PubMed (21831384) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinocembrin 7-rhamnosylglucoside (CHEBI:8222) has functional parent pinocembrin (CHEBI:28157) |
| pinocembrin 7-rhamnosylglucoside (CHEBI:8222) has role plant metabolite (CHEBI:76924) |
| pinocembrin 7-rhamnosylglucoside (CHEBI:8222) is a (2S)-flavan-4-one (CHEBI:140377) |
| pinocembrin 7-rhamnosylglucoside (CHEBI:8222) is a disaccharide derivative (CHEBI:63353) |
| pinocembrin 7-rhamnosylglucoside (CHEBI:8222) is a flavanone glycoside (CHEBI:72730) |
| pinocembrin 7-rhamnosylglucoside (CHEBI:8222) is a monohydroxyflavanone (CHEBI:38748) |
| pinocembrin 7-rhamnosylglucoside (CHEBI:8222) is a neohesperidoside (CHEBI:25495) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-4-oxo-2-phenyl-3,4-dihydro-2H-1-benzopyran-7-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Pinocembrin 7-O-neohesperidoside | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00000993 | KNApSAcK |
| C09828 | KEGG COMPOUND |
| LMPK12140136 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:73145 | Reaxys |
| CAS:13241-31-1 | KEGG COMPOUND |
| Citations |
|---|