EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16Cl2N2O4 |
| Net Charge | 0 |
| Average Mass | 383.231 |
| Monoisotopic Mass | 382.04871 |
| SMILES | CC(Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1)C(=O)N1CCCO1 |
| InChI | InChI=1S/C17H16Cl2N2O4/c1-11(17(22)21-7-2-8-23-21)24-13-3-5-14(6-4-13)25-16-15(19)9-12(18)10-20-16/h3-6,9-11H,2,7-8H2,1H3 |
| InChIKey | ANFHKXSOSRDDRQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoxapyrifop (CHEBI:82198) has role phenoxy herbicide (CHEBI:60575) |
| Isoxapyrifop (CHEBI:82198) is a aromatic ether (CHEBI:35618) |