EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9Cl5O3 |
| Net Charge | 0 |
| Average Mass | 366.455 |
| Monoisotopic Mass | 363.89943 |
| SMILES | CC(Cl)(Cl)C(=O)OCCOc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl5O3/c1-11(15,16)10(17)19-3-2-18-9-5-7(13)6(12)4-8(9)14/h4-5H,2-3H2,1H3 |
| InChIKey | KMHZPJNVPCAUMN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Erbon (CHEBI:82197) has role phenoxy herbicide (CHEBI:60575) |
| Erbon (CHEBI:82197) is a aromatic ether (CHEBI:35618) |