EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8Cl2O5S |
| Net Charge | 0 |
| Average Mass | 287.120 |
| Monoisotopic Mass | 285.94695 |
| SMILES | O=S(=O)(O)OCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2O5S/c9-6-1-2-8(7(10)5-6)14-3-4-15-16(11,12)13/h1-2,5H,3-4H2,(H,11,12,13) |
| InChIKey | HJEINPVZRDJRBY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Disul (CHEBI:82196) has role phenoxy herbicide (CHEBI:60575) |
| Disul (CHEBI:82196) is a aromatic ether (CHEBI:35618) |