EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13ClO4 |
| Net Charge | 0 |
| Average Mass | 292.718 |
| Monoisotopic Mass | 292.05024 |
| SMILES | CC(Oc1cccc(Oc2ccc(Cl)cc2)c1)C(=O)O |
| InChI | InChI=1S/C15H13ClO4/c1-10(15(17)18)19-13-3-2-4-14(9-13)20-12-7-5-11(16)6-8-12/h2-10H,1H3,(H,17,18) |
| InChIKey | MVJSHNOLKGWVHY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Clofop (CHEBI:82195) has role phenoxy herbicide (CHEBI:60575) |
| Clofop (CHEBI:82195) is a aromatic ether (CHEBI:35618) |
| Manual Xrefs | Databases |
|---|---|
| C19070 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:26129-32-8 | KEGG COMPOUND |