EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H7Br2N3O6 |
| Net Charge | 0 |
| Average Mass | 461.022 |
| Monoisotopic Mass | 458.87016 |
| SMILES | O=[N+]([O-])c1ccc(O/N=C/c2cc(Br)c(O)c(Br)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H7Br2N3O6/c14-9-3-7(4-10(15)13(9)19)6-16-24-12-2-1-8(17(20)21)5-11(12)18(22)23/h1-6,19H/b16-6+ |
| InChIKey | XTFNPKDYCLFGPV-OMCISZLKSA-N |
| Roles Classification |
|---|
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bromofenoxim (CHEBI:82194) has role phenoxy herbicide (CHEBI:60575) |
| Bromofenoxim (CHEBI:82194) is a C-nitro compound (CHEBI:35716) |
| Manual Xrefs | Databases |
|---|---|
| C19069 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:13181-17-4 | KEGG COMPOUND |