EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5Cl3O3 |
| Net Charge | 0 |
| Average Mass | 255.484 |
| Monoisotopic Mass | 253.93043 |
| SMILES | COc1c(Cl)cc(Cl)c(Cl)c1C(=O)O |
| InChI | InChI=1S/C8H5Cl3O3/c1-14-7-4(10)2-3(9)6(11)5(7)8(12)13/h2H,1H3,(H,12,13) |
| InChIKey | WCLDITPGPXSPGV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricamba (CHEBI:82184) has role agrochemical (CHEBI:33286) |
| tricamba (CHEBI:82184) has role herbicide (CHEBI:24527) |
| tricamba (CHEBI:82184) has role synthetic auxin (CHEBI:26841) |
| tricamba (CHEBI:82184) is a methoxybenzoic acid (CHEBI:25238) |
| tricamba (CHEBI:82184) is a trichlorobenzene (CHEBI:27096) |
| IUPAC Name |
|---|
| 2,3,5-trichloro-6-methoxybenzoic acid |
| Synonyms | Source |
|---|---|
| 2-methoxy-3,5,6-trichlorobenzoic acid | ChemIDplus |
| 3,5,6-trichloro-2-methoxybenzoic acid | ChemIDplus |
| 3,5,6-trichloro-o-anisic acid | Alan Wood's Pesticides |
| Brand Names | Source |
|---|---|
| Banvel T | ChemIDplus |
| Metriben | ChemIDplus |
| Velsicol C | ChemIDplus |
| Citations |
|---|