EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 206.028 |
| Monoisotopic Mass | 204.96973 |
| SMILES | Nc1cc(Cl)cc(C(=O)O)c1Cl |
| InChI | InChI=1S/C7H5Cl2NO2/c8-3-1-4(7(11)12)6(9)5(10)2-3/h1-2H,10H2,(H,11,12) |
| InChIKey | HSSBORCLYSCBJR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chloramben (CHEBI:82183) is a chlorobenzoic acid (CHEBI:23134) |
| Manual Xrefs | Databases |
|---|---|
| C19056 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:133-90-4 | KEGG COMPOUND |